C27H21FN2O4S — CID 3642407
4-(4-ethoxybenzoyl)-1-(6-fluoro-1,3-benzothiazol-2-yl)-5-(4-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 3642407) has the molecular formula C27H21FN2O4S and a molecular weight of 488.54 g/mol. Its IUPAC name is 4-(4-ethoxybenzoyl)-1-(6-fluoro-1,3-benzothiazol-2-yl)-5-(4-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-(4-ethoxybenzoyl)-1-(6-fluoro-1,3-benzothiazol-2-yl)-5-(4-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3642407 |
| Molecular Formula | C27H21FN2O4S |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 4-(4-ethoxybenzoyl)-1-(6-fluoro-1,3-benzothiazol-2-yl)-5-(4-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(C(=O)C2C(=O)C(=O)N(c3nc4ccc(F)cc4s3)C2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H21FN2O4S/c1-3-34-19-11-8-17(9-12-19)24(31)22-23(16-6-4-15(2)5-7-16)30(26(33)25(22)32)27-29-20-13-10-18(28)14-21(20)35-27/h4-14,22-23H,3H2,1-2H3 |
| InChIKey | JNTCANIPWPBKOM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|