C25H16F2N2O3S — CID 3444119
1-(6-fluoro-1,3-benzothiazol-2-yl)-5-(4-fluorophenyl)-4-(4-methylbenzoyl)pyrrolidine-2,3-dione (PubChem CID 3444119) has the molecular formula C25H16F2N2O3S and a molecular weight of 462.48 g/mol. Its IUPAC name is 1-(6-fluoro-1,3-benzothiazol-2-yl)-5-(4-fluorophenyl)-4-(4-methylbenzoyl)pyrrolidine-2,3-dione.
| Compound Name | 1-(6-fluoro-1,3-benzothiazol-2-yl)-5-(4-fluorophenyl)-4-(4-methylbenzoyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3444119 |
| Molecular Formula | C25H16F2N2O3S |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 1-(6-fluoro-1,3-benzothiazol-2-yl)-5-(4-fluorophenyl)-4-(4-methylbenzoyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C(=O)C2C(=O)C(=O)N(c3nc4ccc(F)cc4s3)C2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H16F2N2O3S/c1-13-2-4-15(5-3-13)22(30)20-21(14-6-8-16(26)9-7-14)29(24(32)23(20)31)25-28-18-11-10-17(27)12-19(18)33-25/h2-12,20-21H,1H3 |
| InChIKey | UDFXULIJKHCPCM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|