C27H19FN2O5S — CID 3736558
methyl 4-[1-(6-fluoro-1,3-benzothiazol-2-yl)-3-[hydroxy-(4-methylphenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 3736558) has the molecular formula C27H19FN2O5S and a molecular weight of 502.52 g/mol. Its IUPAC name is methyl 4-[1-(6-fluoro-1,3-benzothiazol-2-yl)-3-[hydroxy-(4-methylphenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[1-(6-fluoro-1,3-benzothiazol-2-yl)-3-[hydroxy-(4-methylphenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 3736558 |
| Molecular Formula | C27H19FN2O5S |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | methyl 4-[1-(6-fluoro-1,3-benzothiazol-2-yl)-3-[hydroxy-(4-methylphenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C(=C(O)c3ccc(C)cc3)C(=O)C(=O)N2c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C27H19FN2O5S/c1-14-3-5-16(6-4-14)23(31)21-22(15-7-9-17(10-8-15)26(34)35-2)30(25(33)24(21)32)27-29-19-12-11-18(28)13-20(19)36-27/h3-13,22,31H,1-2H3 |
| InChIKey | LBCNWVIBKSRNFK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|