C28H22N2O7S — CID 3415078
methyl 4-[3-[hydroxy-(4-methoxyphenyl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 3415078) has the molecular formula C28H22N2O7S and a molecular weight of 530.56 g/mol. Its IUPAC name is methyl 4-[3-[hydroxy-(4-methoxyphenyl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[3-[hydroxy-(4-methoxyphenyl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 3415078 |
| Molecular Formula | C28H22N2O7S |
| Molecular Weight | 530.56 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | methyl 4-[3-[hydroxy-(4-methoxyphenyl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C(=C(O)c3ccc(OC)cc3)C(=O)C(=O)N2c2nc3ccc(OC)cc3s2)cc1 |
| InChI | InChI=1S/C28H22N2O7S/c1-35-18-10-8-16(9-11-18)24(31)22-23(15-4-6-17(7-5-15)27(34)37-3)30(26(33)25(22)32)28-29-20-13-12-19(36-2)14-21(20)38-28/h4-14,23,31H,1-3H3 |
| InChIKey | HESBOFMRFLDLRC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|