C27H19FN2O6S — CID 3272172
methyl 4-[1-(6-fluoro-1,3-benzothiazol-2-yl)-3-[hydroxy-(4-methoxyphenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 3272172) has the molecular formula C27H19FN2O6S and a molecular weight of 518.52 g/mol. Its IUPAC name is methyl 4-[1-(6-fluoro-1,3-benzothiazol-2-yl)-3-[hydroxy-(4-methoxyphenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[1-(6-fluoro-1,3-benzothiazol-2-yl)-3-[hydroxy-(4-methoxyphenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 3272172 |
| Molecular Formula | C27H19FN2O6S |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | methyl 4-[1-(6-fluoro-1,3-benzothiazol-2-yl)-3-[hydroxy-(4-methoxyphenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C(=C(O)c3ccc(OC)cc3)C(=O)C(=O)N2c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C27H19FN2O6S/c1-35-18-10-7-15(8-11-18)23(31)21-22(14-3-5-16(6-4-14)26(34)36-2)30(25(33)24(21)32)27-29-19-12-9-17(28)13-20(19)37-27/h3-13,22,31H,1-2H3 |
| InChIKey | ADULWKQPJDXXHP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|