C22H18BrN3O3S — CID 3383734
5-(4-bromophenyl)-4-(2,5-dimethylbenzoyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 3383734) has the molecular formula C22H18BrN3O3S and a molecular weight of 484.38 g/mol. Its IUPAC name is 5-(4-bromophenyl)-4-(2,5-dimethylbenzoyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | 5-(4-bromophenyl)-4-(2,5-dimethylbenzoyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3383734 |
| Molecular Formula | C22H18BrN3O3S |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | 5-(4-bromophenyl)-4-(2,5-dimethylbenzoyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C)c(C(=O)C2C(=O)C(=O)N(c3nnc(C)s3)C2c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C22H18BrN3O3S/c1-11-4-5-12(2)16(10-11)19(27)17-18(14-6-8-15(23)9-7-14)26(21(29)20(17)28)22-25-24-13(3)30-22/h4-10,17-18H,1-3H3 |
| InChIKey | HXOOXOQBWKWLHA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|