C19H15NO5 — CID 24828116
2-(4-benzoyl-2,3-dioxo-5-phenylpyrrolidin-1-yl)acetic acid (PubChem CID 24828116) has the molecular formula C19H15NO5 and a molecular weight of 337.33 g/mol. Its IUPAC name is 2-(4-benzoyl-2,3-dioxo-5-phenylpyrrolidin-1-yl)acetic acid.
| Compound Name | 2-(4-benzoyl-2,3-dioxo-5-phenylpyrrolidin-1-yl)acetic acid |
|---|---|
| PubChem CID | 24828116 |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-(4-benzoyl-2,3-dioxo-5-phenylpyrrolidin-1-yl)acetic acid |
| SMILES | O=C(O)CN1C(=O)C(=O)C(C(=O)c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C19H15NO5/c21-14(22)11-20-16(12-7-3-1-4-8-12)15(18(24)19(20)25)17(23)13-9-5-2-6-10-13/h1-10,15-16H,11H2,(H,21,22) |
| InChIKey | RKMPENPSCNQNRC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|