C27H33N3O6S — CID 91897851
1-[2-(diethylamino)ethyl]-4-(4-morpholin-4-ylsulfonylbenzoyl)-5-phenylpyrrolidine-2,3-dione (PubChem CID 91897851) has the molecular formula C27H33N3O6S and a molecular weight of 527.64 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-4-(4-morpholin-4-ylsulfonylbenzoyl)-5-phenylpyrrolidine-2,3-dione.
| Compound Name | 1-[2-(diethylamino)ethyl]-4-(4-morpholin-4-ylsulfonylbenzoyl)-5-phenylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91897851 |
| Molecular Formula | C27H33N3O6S |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-4-(4-morpholin-4-ylsulfonylbenzoyl)-5-phenylpyrrolidine-2,3-dione |
| SMILES | CCN(CC)CCN1C(=O)C(=O)C(C(=O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)C1c1ccccc1 |
| InChI | InChI=1S/C27H33N3O6S/c1-3-28(4-2)14-15-30-24(20-8-6-5-7-9-20)23(26(32)27(30)33)25(31)21-10-12-22(13-11-21)37(34,35)29-16-18-36-19-17-29/h5-13,23-24H,3-4,14-19H2,1-2H3 |
| InChIKey | YXMOBZNFFHGTCM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|