C24H25ClN2O7S — CID 98381126
(4E,5R)-5-(3-chlorophenyl)-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)pyrrolidine-2,3-dione (PubChem CID 98381126) has the molecular formula C24H25ClN2O7S and a molecular weight of 520.99 g/mol. Its IUPAC name is (4E,5R)-5-(3-chlorophenyl)-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-5-(3-chlorophenyl)-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98381126 |
| Molecular Formula | C24H25ClN2O7S |
| Molecular Weight | 520.99 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | (4E,5R)-5-(3-chlorophenyl)-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)pyrrolidine-2,3-dione |
| SMILES | COCCN1C(=O)C(=O)/C(=C(/O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H25ClN2O7S/c1-33-12-11-27-21(17-3-2-4-18(25)15-17)20(23(29)24(27)30)22(28)16-5-7-19(8-6-16)35(31,32)26-9-13-34-14-10-26/h2-8,15,21,28H,9-14H2,1H3/b22-20+/t21-/m1/s1 |
| InChIKey | MVGLPGQDOPMHGH-JBCNATCCSA-N |
| XLogP | 2.43 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.99 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|