C30H30N2O8S — CID 2923435
4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 2923435) has the molecular formula C30H30N2O8S and a molecular weight of 578.64 g/mol. Its IUPAC name is 4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 2923435 |
| Molecular Formula | C30H30N2O8S |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | 4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COCCN1C(=O)C(=O)C(=C(O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)C1c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C30H30N2O8S/c1-38-17-16-32-27(22-6-5-9-24(20-22)40-23-7-3-2-4-8-23)26(29(34)30(32)35)28(33)21-10-12-25(13-11-21)41(36,37)31-14-18-39-19-15-31/h2-13,20,27,33H,14-19H2,1H3 |
| InChIKey | ZVOPOVUABGRUHR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|