C25H28N2O7S — CID 6067165
(4E)-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(3-methoxypropyl)-5-phenylpyrrolidine-2,3-dione (PubChem CID 6067165) has the molecular formula C25H28N2O7S and a molecular weight of 500.57 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(3-methoxypropyl)-5-phenylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(3-methoxypropyl)-5-phenylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6067165 |
| Molecular Formula | C25H28N2O7S |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | (4E)-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(3-methoxypropyl)-5-phenylpyrrolidine-2,3-dione |
| SMILES | COCCCN1C(=O)C(=O)/C(=C(/O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)C1c1ccccc1 |
| InChI | InChI=1S/C25H28N2O7S/c1-33-15-5-12-27-22(18-6-3-2-4-7-18)21(24(29)25(27)30)23(28)19-8-10-20(11-9-19)35(31,32)26-13-16-34-17-14-26/h2-4,6-11,22,28H,5,12-17H2,1H3/b23-21+ |
| InChIKey | MUGIADZICTZCON-XTQSDGFTSA-N |
| XLogP | 2.17 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|