C25H28N2O8S — CID 98382146
(4E,5R)-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)-5-(3-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 98382146) has the molecular formula C25H28N2O8S and a molecular weight of 516.57 g/mol. Its IUPAC name is (4E,5R)-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)-5-(3-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)-5-(3-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98382146 |
| Molecular Formula | C25H28N2O8S |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | (4E,5R)-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)-5-(3-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COCCN1C(=O)C(=O)/C(=C(/O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)[C@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C25H28N2O8S/c1-33-13-12-27-22(18-4-3-5-19(16-18)34-2)21(24(29)25(27)30)23(28)17-6-8-20(9-7-17)36(31,32)26-10-14-35-15-11-26/h3-9,16,22,28H,10-15H2,1-2H3/b23-21+/t22-/m1/s1 |
| InChIKey | MZEJACXDQORJEC-HOGKFDNTSA-N |
| XLogP | 1.78 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|