C30H37N3O9S — CID 6011895
(4E)-5-(3,4-dimethoxyphenyl)-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 6011895) has the molecular formula C30H37N3O9S and a molecular weight of 615.71 g/mol. Its IUPAC name is (4E)-5-(3,4-dimethoxyphenyl)-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(3,4-dimethoxyphenyl)-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6011895 |
| Molecular Formula | C30H37N3O9S |
| Molecular Weight | 615.71 g/mol |
| Exact Mass | 615.23 |
| IUPAC Name | (4E)-5-(3,4-dimethoxyphenyl)-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2/C(=C(\O)c3ccc(S(=O)(=O)N4CCOCC4)cc3)C(=O)C(=O)N2CCCN2CCOCC2)cc1OC |
| InChI | InChI=1S/C30H37N3O9S/c1-39-24-9-6-22(20-25(24)40-2)27-26(29(35)30(36)33(27)11-3-10-31-12-16-41-17-13-31)28(34)21-4-7-23(8-5-21)43(37,38)32-14-18-42-19-15-32/h4-9,20,27,34H,3,10-19H2,1-2H3/b28-26+ |
| InChIKey | IFQRFNSPYQTPGW-BYCLXTJYSA-N |
| XLogP | 1.87 |
| TPSA | 135.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.71 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|