C25H28N2O9S — CID 93472798
(5R)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)pyrrolidine-2,3-dione (PubChem CID 93472798) has the molecular formula C25H28N2O9S and a molecular weight of 532.57 g/mol. Its IUPAC name is (5R)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 93472798 |
| Molecular Formula | C25H28N2O9S |
| Molecular Weight | 532.57 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | (5R)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)pyrrolidine-2,3-dione |
| SMILES | COCCN1C(=O)C(=O)C(=C(O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)[C@H]1c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C25H28N2O9S/c1-34-12-11-27-22(17-5-8-19(28)20(15-17)35-2)21(24(30)25(27)31)23(29)16-3-6-18(7-4-16)37(32,33)26-9-13-36-14-10-26/h3-8,15,22,28-29H,9-14H2,1-2H3/t22-/m1/s1 |
| InChIKey | NDXLYWNSWJLYDC-JOCHJYFZSA-N |
| XLogP | 1.49 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.57 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|