C26H30N2O8S — CID 98326159
(4E,5S)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-(4-piperidin-1-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)pyrrolidine-2,3-dione (PubChem CID 98326159) has the molecular formula C26H30N2O8S and a molecular weight of 530.60 g/mol. Its IUPAC name is (4E,5S)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-(4-piperidin-1-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-(4-piperidin-1-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98326159 |
| Molecular Formula | C26H30N2O8S |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | (4E,5S)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-(4-piperidin-1-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)pyrrolidine-2,3-dione |
| SMILES | COCCN1C(=O)C(=O)/C(=C(/O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)[C@@H]1c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C26H30N2O8S/c1-35-15-14-28-23(18-8-11-20(29)21(16-18)36-2)22(25(31)26(28)32)24(30)17-6-9-19(10-7-17)37(33,34)27-12-4-3-5-13-27/h6-11,16,23,29-30H,3-5,12-15H2,1-2H3/b24-22+/t23-/m0/s1 |
| InChIKey | KBEBQWKYUJQNGD-AYWGPLOBSA-N |
| XLogP | 2.64 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|