C28H34N2O6S — CID 6222669
(4Z)-4-[hydroxy-(4-piperidin-1-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione (PubChem CID 6222669) has the molecular formula C28H34N2O6S and a molecular weight of 526.66 g/mol. Its IUPAC name is (4Z)-4-[hydroxy-(4-piperidin-1-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[hydroxy-(4-piperidin-1-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6222669 |
| Molecular Formula | C28H34N2O6S |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | (4Z)-4-[hydroxy-(4-piperidin-1-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione |
| SMILES | COCCN1C(=O)C(=O)/C(=C(\O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)C1c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C28H34N2O6S/c1-19(2)20-7-9-21(10-8-20)25-24(27(32)28(33)30(25)17-18-36-3)26(31)22-11-13-23(14-12-22)37(34,35)29-15-5-4-6-16-29/h7-14,19,25,31H,4-6,15-18H2,1-3H3/b26-24- |
| InChIKey | QLQRAUVFFJOXAK-LCUIJRPUSA-N |
| XLogP | 4.05 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|