C25H27FN2O6S — CID 41010762
(5S)-5-(2-fluorophenyl)-4-[hydroxy-(4-piperidin-1-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)pyrrolidine-2,3-dione (PubChem CID 41010762) has the molecular formula C25H27FN2O6S and a molecular weight of 502.56 g/mol. Its IUPAC name is (5S)-5-(2-fluorophenyl)-4-[hydroxy-(4-piperidin-1-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)pyrrolidine-2,3-dione.
| Compound Name | (5S)-5-(2-fluorophenyl)-4-[hydroxy-(4-piperidin-1-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 41010762 |
| Molecular Formula | C25H27FN2O6S |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | (5S)-5-(2-fluorophenyl)-4-[hydroxy-(4-piperidin-1-ylsulfonylphenyl)methylidene]-1-(2-methoxyethyl)pyrrolidine-2,3-dione |
| SMILES | COCCN1C(=O)C(=O)C(=C(O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)[C@H]1c1ccccc1F |
| InChI | InChI=1S/C25H27FN2O6S/c1-34-16-15-28-22(19-7-3-4-8-20(19)26)21(24(30)25(28)31)23(29)17-9-11-18(12-10-17)35(32,33)27-13-5-2-6-14-27/h3-4,7-12,22,29H,2,5-6,13-16H2,1H3/t22-/m1/s1 |
| InChIKey | DVFXLXDEQSCMIY-JOCHJYFZSA-N |
| XLogP | 3.07 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|