C22H20FNO6 — CID 98380657
(4E,5S)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(2-fluorophenyl)-1-(2-methoxyethyl)pyrrolidine-2,3-dione (PubChem CID 98380657) has the molecular formula C22H20FNO6 and a molecular weight of 413.40 g/mol. Its IUPAC name is (4E,5S)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(2-fluorophenyl)-1-(2-methoxyethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(2-fluorophenyl)-1-(2-methoxyethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98380657 |
| Molecular Formula | C22H20FNO6 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | (4E,5S)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(2-fluorophenyl)-1-(2-methoxyethyl)pyrrolidine-2,3-dione |
| SMILES | COCCN1C(=O)C(=O)/C(=C(/O)c2ccc3c(c2)OCCO3)[C@H]1c1ccccc1F |
| InChI | InChI=1S/C22H20FNO6/c1-28-9-8-24-19(14-4-2-3-5-15(14)23)18(21(26)22(24)27)20(25)13-6-7-16-17(12-13)30-11-10-29-16/h2-7,12,19,25H,8-11H2,1H3/b20-18+/t19-/m1/s1 |
| InChIKey | YQXGZZBBNYXAEF-LFVOPCPISA-N |
| XLogP | 2.66 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|