C27H22FNO5 — CID 2946795
4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(2-fluorophenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione (PubChem CID 2946795) has the molecular formula C27H22FNO5 and a molecular weight of 459.47 g/mol. Its IUPAC name is 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(2-fluorophenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(2-fluorophenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 2946795 |
| Molecular Formula | C27H22FNO5 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(2-fluorophenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCc2ccccc2)C(c2ccccc2F)C1=C(O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C27H22FNO5/c28-20-9-5-4-8-19(20)24-23(25(30)18-10-11-21-22(16-18)34-15-14-33-21)26(31)27(32)29(24)13-12-17-6-2-1-3-7-17/h1-11,16,24,30H,12-15H2 |
| InChIKey | VQFLEKPGWHENQX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|