C25H21NO6 — CID 3427187
4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(furan-2-yl)-1-(2-phenylethyl)pyrrolidine-2,3-dione (PubChem CID 3427187) has the molecular formula C25H21NO6 and a molecular weight of 431.44 g/mol. Its IUPAC name is 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(furan-2-yl)-1-(2-phenylethyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(furan-2-yl)-1-(2-phenylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3427187 |
| Molecular Formula | C25H21NO6 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(furan-2-yl)-1-(2-phenylethyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCc2ccccc2)C(c2ccco2)C1=C(O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C25H21NO6/c27-23(17-8-9-18-20(15-17)32-14-13-31-18)21-22(19-7-4-12-30-19)26(25(29)24(21)28)11-10-16-5-2-1-3-6-16/h1-9,12,15,22,27H,10-11,13-14H2 |
| InChIKey | MMGJOMPBMWKGMF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|