C23H26N2O6 — CID 6133705
(4E)-1-[2-(diethylamino)ethyl]-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(furan-2-yl)pyrrolidine-2,3-dione (PubChem CID 6133705) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is (4E)-1-[2-(diethylamino)ethyl]-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(furan-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-[2-(diethylamino)ethyl]-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(furan-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6133705 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | (4E)-1-[2-(diethylamino)ethyl]-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(furan-2-yl)pyrrolidine-2,3-dione |
| SMILES | CCN(CC)CCN1C(=O)C(=O)/C(=C(/O)c2ccc3c(c2)OCCO3)C1c1ccco1 |
| InChI | InChI=1S/C23H26N2O6/c1-3-24(4-2)9-10-25-20(17-6-5-11-29-17)19(22(27)23(25)28)21(26)15-7-8-16-18(14-15)31-13-12-30-16/h5-8,11,14,20,26H,3-4,9-10,12-13H2,1-2H3/b21-19+ |
| InChIKey | CLPLFWCCPGXSMC-XUTLUUPISA-N |
| XLogP | 2.81 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|