C25H26Cl2N2O5 — CID 27308525
(5S)-5-(2,4-dichlorophenyl)-1-[2-(diethylamino)ethyl]-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione (PubChem CID 27308525) has the molecular formula C25H26Cl2N2O5 and a molecular weight of 505.40 g/mol. Its IUPAC name is (5S)-5-(2,4-dichlorophenyl)-1-[2-(diethylamino)ethyl]-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (5S)-5-(2,4-dichlorophenyl)-1-[2-(diethylamino)ethyl]-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 27308525 |
| Molecular Formula | C25H26Cl2N2O5 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | (5S)-5-(2,4-dichlorophenyl)-1-[2-(diethylamino)ethyl]-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCN(CC)CCN1C(=O)C(=O)C(=C(O)c2ccc3c(c2)OCCO3)[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H26Cl2N2O5/c1-3-28(4-2)9-10-29-22(17-7-6-16(26)14-18(17)27)21(24(31)25(29)32)23(30)15-5-8-19-20(13-15)34-12-11-33-19/h5-8,13-14,22,30H,3-4,9-12H2,1-2H3/t22-/m1/s1 |
| InChIKey | MUNMFIDKZNRDNF-JOCHJYFZSA-N |
| XLogP | 4.53 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|