C25H24Cl2N2O6 — CID 6133321
(4E)-5-(2,4-dichlorophenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione (PubChem CID 6133321) has the molecular formula C25H24Cl2N2O6 and a molecular weight of 519.38 g/mol. Its IUPAC name is (4E)-5-(2,4-dichlorophenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(2,4-dichlorophenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6133321 |
| Molecular Formula | C25H24Cl2N2O6 |
| Molecular Weight | 519.38 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | (4E)-5-(2,4-dichlorophenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCN2CCOCC2)C(c2ccc(Cl)cc2Cl)/C1=C(\O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C25H24Cl2N2O6/c26-16-2-3-17(18(27)14-16)22-21(23(30)15-1-4-19-20(13-15)35-12-11-34-19)24(31)25(32)29(22)6-5-28-7-9-33-10-8-28/h1-4,13-14,22,30H,5-12H2/b23-21+ |
| InChIKey | LPOOZUQAZKLROQ-XTQSDGFTSA-N |
| XLogP | 3.52 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|