C28H35N3O6S — CID 93473875
(5S)-1-[2-(diethylamino)ethyl]-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-5-(4-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 93473875) has the molecular formula C28H35N3O6S and a molecular weight of 541.67 g/mol. Its IUPAC name is (5S)-1-[2-(diethylamino)ethyl]-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-5-(4-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (5S)-1-[2-(diethylamino)ethyl]-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-5-(4-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 93473875 |
| Molecular Formula | C28H35N3O6S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | (5S)-1-[2-(diethylamino)ethyl]-4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-5-(4-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCN(CC)CCN1C(=O)C(=O)C(=C(O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C28H35N3O6S/c1-4-29(5-2)14-15-31-25(21-8-6-20(3)7-9-21)24(27(33)28(31)34)26(32)22-10-12-23(13-11-22)38(35,36)30-16-18-37-19-17-30/h6-13,25,32H,4-5,14-19H2,1-3H3/t25-/m0/s1 |
| InChIKey | IUDOBAPZKKBPMT-VWLOTQADSA-N |
| XLogP | 2.78 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|