C24H30N2O4S — CID 56800413
(4-morpholin-4-ylsulfonylphenyl)-[2-(1-phenylpropyl)pyrrolidin-1-yl]methanone (PubChem CID 56800413) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is (4-morpholin-4-ylsulfonylphenyl)-[2-(1-phenylpropyl)pyrrolidin-1-yl]methanone.
| Compound Name | (4-morpholin-4-ylsulfonylphenyl)-[2-(1-phenylpropyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 56800413 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (4-morpholin-4-ylsulfonylphenyl)-[2-(1-phenylpropyl)pyrrolidin-1-yl]methanone |
| SMILES | CCC(c1ccccc1)C1CCCN1C(=O)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H30N2O4S/c1-2-22(19-7-4-3-5-8-19)23-9-6-14-26(23)24(27)20-10-12-21(13-11-20)31(28,29)25-15-17-30-18-16-25/h3-5,7-8,10-13,22-23H,2,6,9,14-18H2,1H3 |
| InChIKey | UHYJRFLURFRWGM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |