C22H26N2O6S2 — CID 90585697
[2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-(4-morpholin-4-ylsulfonylphenyl)methanone (PubChem CID 90585697) has the molecular formula C22H26N2O6S2 and a molecular weight of 478.59 g/mol. Its IUPAC name is [2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-(4-morpholin-4-ylsulfonylphenyl)methanone.
| Compound Name | [2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-(4-morpholin-4-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 90585697 |
| Molecular Formula | C22H26N2O6S2 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | [2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-(4-morpholin-4-ylsulfonylphenyl)methanone |
| SMILES | O=C(c1ccc(S(=O)(=O)N2CCOCC2)cc1)N1CCCC1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O6S2/c25-22(18-8-10-21(11-9-18)32(28,29)23-13-15-30-16-14-23)24-12-4-5-19(24)17-31(26,27)20-6-2-1-3-7-20/h1-3,6-11,19H,4-5,12-17H2 |
| InChIKey | WHMCIVGTJUYIEG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |