C18H18N2O5S — CID 90585607
[2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-(3-nitrophenyl)methanone (PubChem CID 90585607) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is [2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-(3-nitrophenyl)methanone.
| Compound Name | [2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 90585607 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | [2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-(3-nitrophenyl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N1CCCC1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O5S/c21-18(14-6-4-7-15(12-14)20(22)23)19-11-5-8-16(19)13-26(24,25)17-9-2-1-3-10-17/h1-4,6-7,9-10,12,16H,5,8,11,13H2 |
| InChIKey | NOOPNGBTIXAZSO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|