C18H18BrNO3S — CID 90585652
[2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-(3-bromophenyl)methanone (PubChem CID 90585652) has the molecular formula C18H18BrNO3S and a molecular weight of 408.32 g/mol. Its IUPAC name is [2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-(3-bromophenyl)methanone.
| Compound Name | [2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-(3-bromophenyl)methanone |
|---|---|
| PubChem CID | 90585652 |
| Molecular Formula | C18H18BrNO3S |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | [2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-(3-bromophenyl)methanone |
| SMILES | O=C(c1cccc(Br)c1)N1CCCC1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18BrNO3S/c19-15-7-4-6-14(12-15)18(21)20-11-5-8-16(20)13-24(22,23)17-9-2-1-3-10-17/h1-4,6-7,9-10,12,16H,5,8,11,13H2 |
| InChIKey | LQWIRNNIAKKSSN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |