C17H16BrNO — CID 41264423
(3-bromophenyl)-[(2R)-2-phenylpyrrolidin-1-yl]methanone (PubChem CID 41264423) has the molecular formula C17H16BrNO and a molecular weight of 330.23 g/mol. Its IUPAC name is (3-bromophenyl)-[(2R)-2-phenylpyrrolidin-1-yl]methanone.
| Compound Name | (3-bromophenyl)-[(2R)-2-phenylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 41264423 |
| Molecular Formula | C17H16BrNO |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | (3-bromophenyl)-[(2R)-2-phenylpyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cccc(Br)c1)N1CCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H16BrNO/c18-15-9-4-8-14(12-15)17(20)19-11-5-10-16(19)13-6-2-1-3-7-13/h1-4,6-9,12,16H,5,10-11H2/t16-/m1/s1 |
| InChIKey | NINXJXDNJRATHT-MRXNPFEDSA-N |
| XLogP | 4.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |