C16H15BrN2O — CID 46632632
(3-bromophenyl)-(2-pyridin-4-ylpyrrolidin-1-yl)methanone (PubChem CID 46632632) has the molecular formula C16H15BrN2O and a molecular weight of 331.21 g/mol. Its IUPAC name is (3-bromophenyl)-(2-pyridin-4-ylpyrrolidin-1-yl)methanone.
| Compound Name | (3-bromophenyl)-(2-pyridin-4-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 46632632 |
| Molecular Formula | C16H15BrN2O |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | (3-bromophenyl)-(2-pyridin-4-ylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1cccc(Br)c1)N1CCCC1c1ccncc1 |
| InChI | InChI=1S/C16H15BrN2O/c17-14-4-1-3-13(11-14)16(20)19-10-2-5-15(19)12-6-8-18-9-7-12/h1,3-4,6-9,11,15H,2,5,10H2 |
| InChIKey | CELMYULGNSDFGR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |