C23H23N3O4S — CID 43043956
N-(2-methoxyphenyl)-3-(2-pyridin-4-ylpyrrolidine-1-carbonyl)benzenesulfonamide (PubChem CID 43043956) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-3-(2-pyridin-4-ylpyrrolidine-1-carbonyl)benzenesulfonamide.
| Compound Name | N-(2-methoxyphenyl)-3-(2-pyridin-4-ylpyrrolidine-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43043956 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N-(2-methoxyphenyl)-3-(2-pyridin-4-ylpyrrolidine-1-carbonyl)benzenesulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cccc(C(=O)N2CCCC2c2ccncc2)c1 |
| InChI | InChI=1S/C23H23N3O4S/c1-30-22-10-3-2-8-20(22)25-31(28,29)19-7-4-6-18(16-19)23(27)26-15-5-9-21(26)17-11-13-24-14-12-17/h2-4,6-8,10-14,16,21,25H,5,9,15H2,1H3 |
| InChIKey | DNBVQGPQGUPEQE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |