C28H31N3O5 — CID 55764627
N-(2-methoxyphenyl)-2-[2-methoxy-4-(2-pyridin-4-ylazepane-1-carbonyl)phenoxy]acetamide (PubChem CID 55764627) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-[2-methoxy-4-(2-pyridin-4-ylazepane-1-carbonyl)phenoxy]acetamide.
| Compound Name | N-(2-methoxyphenyl)-2-[2-methoxy-4-(2-pyridin-4-ylazepane-1-carbonyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 55764627 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | N-(2-methoxyphenyl)-2-[2-methoxy-4-(2-pyridin-4-ylazepane-1-carbonyl)phenoxy]acetamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(C(=O)N2CCCCCC2c2ccncc2)cc1OC |
| InChI | InChI=1S/C28H31N3O5/c1-34-24-10-6-5-8-22(24)30-27(32)19-36-25-12-11-21(18-26(25)35-2)28(33)31-17-7-3-4-9-23(31)20-13-15-29-16-14-20/h5-6,8,10-16,18,23H,3-4,7,9,17,19H2,1-2H3,(H,30,32) |
| InChIKey | UBYAVCCJNKCMIS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |