C27H32N2O7 — CID 55513605
methyl 1-[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 55513605) has the molecular formula C27H32N2O7 and a molecular weight of 496.56 g/mol. Its IUPAC name is methyl 1-[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl 1-[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 55513605 |
| Molecular Formula | C27H32N2O7 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | methyl 1-[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)C1CC2CCCCC2N1C(=O)c1ccc(OCC(=O)Nc2ccccc2OC)c(OC)c1 |
| InChI | InChI=1S/C27H32N2O7/c1-33-22-11-7-5-9-19(22)28-25(30)16-36-23-13-12-18(15-24(23)34-2)26(31)29-20-10-6-4-8-17(20)14-21(29)27(32)35-3/h5,7,9,11-13,15,17,20-21H,4,6,8,10,14,16H2,1-3H3,(H,28,30) |
| InChIKey | YMBOWORQKHIDLC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |