C19H20BrNO2S — CID 95140060
[(2R)-2-(3-bromophenyl)pyrrolidin-1-yl]-[3-[[(R)-methylsulfinyl]methyl]phenyl]methanone (PubChem CID 95140060) has the molecular formula C19H20BrNO2S and a molecular weight of 406.35 g/mol. Its IUPAC name is [(2R)-2-(3-bromophenyl)pyrrolidin-1-yl]-[3-[[(R)-methylsulfinyl]methyl]phenyl]methanone.
| Compound Name | [(2R)-2-(3-bromophenyl)pyrrolidin-1-yl]-[3-[[(R)-methylsulfinyl]methyl]phenyl]methanone |
|---|---|
| PubChem CID | 95140060 |
| Molecular Formula | C19H20BrNO2S |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | [(2R)-2-(3-bromophenyl)pyrrolidin-1-yl]-[3-[[(R)-methylsulfinyl]methyl]phenyl]methanone |
| SMILES | C[S@@](=O)Cc1cccc(C(=O)N2CCC[C@@H]2c2cccc(Br)c2)c1 |
| InChI | InChI=1S/C19H20BrNO2S/c1-24(23)13-14-5-2-7-16(11-14)19(22)21-10-4-9-18(21)15-6-3-8-17(20)12-15/h2-3,5-8,11-12,18H,4,9-10,13H2,1H3/t18-,24-/m1/s1 |
| InChIKey | LOYHGSURUCAZIL-HOYKHHGWSA-N |
| XLogP | 4.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |