C22H27NO4S — CID 90585646
[2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-(4-butoxyphenyl)methanone (PubChem CID 90585646) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is [2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-(4-butoxyphenyl)methanone.
| Compound Name | [2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-(4-butoxyphenyl)methanone |
|---|---|
| PubChem CID | 90585646 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | [2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-(4-butoxyphenyl)methanone |
| SMILES | CCCCOc1ccc(C(=O)N2CCCC2CS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H27NO4S/c1-2-3-16-27-20-13-11-18(12-14-20)22(24)23-15-7-8-19(23)17-28(25,26)21-9-5-4-6-10-21/h4-6,9-14,19H,2-3,7-8,15-17H2,1H3 |
| InChIKey | QRXKATVEKNKPMQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|