C27H19FN2O5 — CID 123172145
5-(2-fluorophenyl)-4-(4-methoxybenzoyl)-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione (PubChem CID 123172145) has the molecular formula C27H19FN2O5 and a molecular weight of 470.46 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-4-(4-methoxybenzoyl)-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | 5-(2-fluorophenyl)-4-(4-methoxybenzoyl)-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123172145 |
| Molecular Formula | C27H19FN2O5 |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 5-(2-fluorophenyl)-4-(4-methoxybenzoyl)-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(=O)C2C(=O)C(=O)N(c3ccc(-c4ccon4)cc3)C2c2ccccc2F)cc1 |
| InChI | InChI=1S/C27H19FN2O5/c1-34-19-12-8-17(9-13-19)25(31)23-24(20-4-2-3-5-21(20)28)30(27(33)26(23)32)18-10-6-16(7-11-18)22-14-15-35-29-22/h2-15,23-24H,1H3 |
| InChIKey | HHHZJZWBVLORNS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|