C24H22BrNO2 — CID 11373951
ethyl (2R,3R)-1-benzhydryl-3-(4-bromophenyl)aziridine-2-carboxylate (PubChem CID 11373951) has the molecular formula C24H22BrNO2 and a molecular weight of 436.35 g/mol. Its IUPAC name is ethyl (2R,3R)-1-benzhydryl-3-(4-bromophenyl)aziridine-2-carboxylate.
| Compound Name | ethyl (2R,3R)-1-benzhydryl-3-(4-bromophenyl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 11373951 |
| Molecular Formula | C24H22BrNO2 |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | ethyl (2R,3R)-1-benzhydryl-3-(4-bromophenyl)aziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H](c2ccc(Br)cc2)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H22BrNO2/c1-2-28-24(27)23-22(19-13-15-20(25)16-14-19)26(23)21(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-16,21-23H,2H2,1H3/t22-,23-,26?/m1/s1 |
| InChIKey | NVSCAIBIIRFHJA-JIISWEIGSA-N |
| XLogP | 5.53 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|