C22H23NO2 — CID 71210393
ethyl 2-benzhydryl-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylate (PubChem CID 71210393) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is ethyl 2-benzhydryl-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylate.
| Compound Name | ethyl 2-benzhydryl-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylate |
|---|---|
| PubChem CID | 71210393 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | ethyl 2-benzhydryl-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylate |
| SMILES | CCOC(=O)C1C2C=CC(C2)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H23NO2/c1-2-25-22(24)21-18-13-14-19(15-18)23(21)20(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-14,18-21H,2,15H2,1H3 |
| InChIKey | DNECAYUSZHPTKI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|