C22H27NO3 — CID 15552371
ethyl (2S,5R,6S)-1-benzhydryl-5-hydroxy-6-methylpiperidine-2-carboxylate (PubChem CID 15552371) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is ethyl (2S,5R,6S)-1-benzhydryl-5-hydroxy-6-methylpiperidine-2-carboxylate.
| Compound Name | ethyl (2S,5R,6S)-1-benzhydryl-5-hydroxy-6-methylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 15552371 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | ethyl (2S,5R,6S)-1-benzhydryl-5-hydroxy-6-methylpiperidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC[C@@H](O)[C@H](C)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO3/c1-3-26-22(25)19-14-15-20(24)16(2)23(19)21(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,16,19-21,24H,3,14-15H2,1-2H3/t16-,19-,20+/m0/s1 |
| InChIKey | AXAFQCWAVUQEEJ-FFZOFVMBSA-N |
| XLogP | 3.55 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |