C31H37NO5 — CID 46915844
ethyl (2R,3R)-1-[bis(4-methoxy-3,5-dimethylphenyl)methyl]-3-(4-methoxyphenyl)aziridine-2-carboxylate (PubChem CID 46915844) has the molecular formula C31H37NO5 and a molecular weight of 503.64 g/mol. Its IUPAC name is ethyl (2R,3R)-1-[bis(4-methoxy-3,5-dimethylphenyl)methyl]-3-(4-methoxyphenyl)aziridine-2-carboxylate.
| Compound Name | ethyl (2R,3R)-1-[bis(4-methoxy-3,5-dimethylphenyl)methyl]-3-(4-methoxyphenyl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 46915844 |
| Molecular Formula | C31H37NO5 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | ethyl (2R,3R)-1-[bis(4-methoxy-3,5-dimethylphenyl)methyl]-3-(4-methoxyphenyl)aziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H](c2ccc(OC)cc2)N1C(c1cc(C)c(OC)c(C)c1)c1cc(C)c(OC)c(C)c1 |
| InChI | InChI=1S/C31H37NO5/c1-9-37-31(33)28-27(22-10-12-25(34-6)13-11-22)32(28)26(23-14-18(2)29(35-7)19(3)15-23)24-16-20(4)30(36-8)21(5)17-24/h10-17,26-28H,9H2,1-8H3/t27-,28-,32?/m1/s1 |
| InChIKey | RMFSZRZHOMCMAE-OZIXFKSASA-N |
| XLogP | 6.02 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|