C31H37NO5 — CID 46914089
ethyl (E)-3-[bis(4-methoxy-3,5-dimethylphenyl)methylamino]-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 46914089) has the molecular formula C31H37NO5 and a molecular weight of 503.64 g/mol. Its IUPAC name is ethyl (E)-3-[bis(4-methoxy-3,5-dimethylphenyl)methylamino]-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-[bis(4-methoxy-3,5-dimethylphenyl)methylamino]-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 46914089 |
| Molecular Formula | C31H37NO5 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | ethyl (E)-3-[bis(4-methoxy-3,5-dimethylphenyl)methylamino]-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C(/NC(c1cc(C)c(OC)c(C)c1)c1cc(C)c(OC)c(C)c1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C31H37NO5/c1-9-37-28(33)18-27(23-10-12-26(34-6)13-11-23)32-29(24-14-19(2)30(35-7)20(3)15-24)25-16-21(4)31(36-8)22(5)17-25/h10-18,29,32H,9H2,1-8H3/b27-18+ |
| InChIKey | MZWJTHIKZCKKOA-OVVQPSECSA-N |
| XLogP | 6.23 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|