C30H34BrNO4 — CID 46916135
ethyl (E)-3-[bis(4-methoxy-3,5-dimethylphenyl)methylamino]-2-(4-bromophenyl)prop-2-enoate (PubChem CID 46916135) has the molecular formula C30H34BrNO4 and a molecular weight of 552.51 g/mol. Its IUPAC name is ethyl (E)-3-[bis(4-methoxy-3,5-dimethylphenyl)methylamino]-2-(4-bromophenyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-[bis(4-methoxy-3,5-dimethylphenyl)methylamino]-2-(4-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 46916135 |
| Molecular Formula | C30H34BrNO4 |
| Molecular Weight | 552.51 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | ethyl (E)-3-[bis(4-methoxy-3,5-dimethylphenyl)methylamino]-2-(4-bromophenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/NC(c1cc(C)c(OC)c(C)c1)c1cc(C)c(OC)c(C)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C30H34BrNO4/c1-8-36-30(33)26(22-9-11-25(31)12-10-22)17-32-27(23-13-18(2)28(34-6)19(3)14-23)24-15-20(4)29(35-7)21(5)16-24/h9-17,27,32H,8H2,1-7H3/b26-17+ |
| InChIKey | KWXLKSFXYUZJLK-YZSQISJMSA-N |
| XLogP | 6.98 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.51 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|