C19H21NO3 — CID 101067614
ethyl (2S,3R)-1-benzyl-3-(4-methoxyphenyl)aziridine-2-carboxylate (PubChem CID 101067614) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is ethyl (2S,3R)-1-benzyl-3-(4-methoxyphenyl)aziridine-2-carboxylate.
| Compound Name | ethyl (2S,3R)-1-benzyl-3-(4-methoxyphenyl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 101067614 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | ethyl (2S,3R)-1-benzyl-3-(4-methoxyphenyl)aziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](c2ccc(OC)cc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H21NO3/c1-3-23-19(21)18-17(15-9-11-16(22-2)12-10-15)20(18)13-14-7-5-4-6-8-14/h4-12,17-18H,3,13H2,1-2H3/t17-,18+,20?/m1/s1 |
| InChIKey | YGIWFSSSINNALF-ZOVQDZKKSA-N |
| XLogP | 3.18 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|