C21H25NO5 — CID 101426746
ethyl (2S,3R)-3-phenyl-1-[(3,4,5-trimethoxyphenyl)methyl]aziridine-2-carboxylate (PubChem CID 101426746) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is ethyl (2S,3R)-3-phenyl-1-[(3,4,5-trimethoxyphenyl)methyl]aziridine-2-carboxylate.
| Compound Name | ethyl (2S,3R)-3-phenyl-1-[(3,4,5-trimethoxyphenyl)methyl]aziridine-2-carboxylate |
|---|---|
| PubChem CID | 101426746 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | ethyl (2S,3R)-3-phenyl-1-[(3,4,5-trimethoxyphenyl)methyl]aziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](c2ccccc2)N1Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H25NO5/c1-5-27-21(23)19-18(15-9-7-6-8-10-15)22(19)13-14-11-16(24-2)20(26-4)17(12-14)25-3/h6-12,18-19H,5,13H2,1-4H3/t18-,19+,22?/m1/s1 |
| InChIKey | CGCACGCSEYARAK-DKPCLATOSA-N |
| XLogP | 3.20 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|