C22H25NO5 — CID 123494197
ethyl 1-[(3,4,5-trimethoxyphenyl)methylamino]-1H-indene-2-carboxylate (PubChem CID 123494197) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is ethyl 1-[(3,4,5-trimethoxyphenyl)methylamino]-1H-indene-2-carboxylate.
| Compound Name | ethyl 1-[(3,4,5-trimethoxyphenyl)methylamino]-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 123494197 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | ethyl 1-[(3,4,5-trimethoxyphenyl)methylamino]-1H-indene-2-carboxylate |
| SMILES | CCOC(=O)C1=Cc2ccccc2C1NCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H25NO5/c1-5-28-22(24)17-12-15-8-6-7-9-16(15)20(17)23-13-14-10-18(25-2)21(27-4)19(11-14)26-3/h6-12,20,23H,5,13H2,1-4H3 |
| InChIKey | MJPGBVZEUHPRGZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |