C13H19NO5 — CID 18168994
N-ethoxy-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 18168994) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is N-ethoxy-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-ethoxy-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 18168994 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | N-ethoxy-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | CCONC(=O)Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C13H19NO5/c1-5-19-14-12(15)8-9-6-10(16-2)13(18-4)11(7-9)17-3/h6-7H,5,8H2,1-4H3,(H,14,15) |
| InChIKey | WJGKQESRZVMANP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|