C19H25NO3 — CID 119137895
1-(2-ethylphenyl)-N-[(3,4,5-trimethoxyphenyl)methyl]methanamine (PubChem CID 119137895) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-N-[(3,4,5-trimethoxyphenyl)methyl]methanamine.
| Compound Name | 1-(2-ethylphenyl)-N-[(3,4,5-trimethoxyphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 119137895 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 1-(2-ethylphenyl)-N-[(3,4,5-trimethoxyphenyl)methyl]methanamine |
| SMILES | CCc1ccccc1CNCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C19H25NO3/c1-5-15-8-6-7-9-16(15)13-20-12-14-10-17(21-2)19(23-4)18(11-14)22-3/h6-11,20H,5,12-13H2,1-4H3 |
| InChIKey | JTAMJZPNKGYBBX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |