C17H16N2O4 — CID 12982646
methyl (2S,3R)-1-benzyl-3-(3-nitrophenyl)aziridine-2-carboxylate (PubChem CID 12982646) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is methyl (2S,3R)-1-benzyl-3-(3-nitrophenyl)aziridine-2-carboxylate.
| Compound Name | methyl (2S,3R)-1-benzyl-3-(3-nitrophenyl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 12982646 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | methyl (2S,3R)-1-benzyl-3-(3-nitrophenyl)aziridine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](c2cccc([N+](=O)[O-])c2)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H16N2O4/c1-23-17(20)16-15(13-8-5-9-14(10-13)19(21)22)18(16)11-12-6-3-2-4-7-12/h2-10,15-16H,11H2,1H3/t15-,16+,18?/m1/s1 |
| InChIKey | DCLGQPBKFXQKAK-LNKXUWQBSA-N |
| XLogP | 2.69 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|