C29H27N3O9 — CID 24774527
dimethyl (2R,6S)-1-[(4-methylphenyl)methyl]-2,6-bis(3-nitrophenyl)-4-oxopiperidine-3,5-dicarboxylate (PubChem CID 24774527) has the molecular formula C29H27N3O9 and a molecular weight of 561.55 g/mol. Its IUPAC name is dimethyl (2R,6S)-1-[(4-methylphenyl)methyl]-2,6-bis(3-nitrophenyl)-4-oxopiperidine-3,5-dicarboxylate.
| Compound Name | dimethyl (2R,6S)-1-[(4-methylphenyl)methyl]-2,6-bis(3-nitrophenyl)-4-oxopiperidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 24774527 |
| Molecular Formula | C29H27N3O9 |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | dimethyl (2R,6S)-1-[(4-methylphenyl)methyl]-2,6-bis(3-nitrophenyl)-4-oxopiperidine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(=O)C(C(=O)OC)[C@@H](c2cccc([N+](=O)[O-])c2)N(Cc2ccc(C)cc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H27N3O9/c1-17-10-12-18(13-11-17)16-30-25(19-6-4-8-21(14-19)31(36)37)23(28(34)40-2)27(33)24(29(35)41-3)26(30)20-7-5-9-22(15-20)32(38)39/h4-15,23-26H,16H2,1-3H3/t23?,24?,25-,26?/m1/s1 |
| InChIKey | SHBPNAQMFSSEMQ-JNLVHHEDSA-N |
| XLogP | 4.26 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|