C27H27N3O5 — CID 91554881
(2R,6S)-2,3-dimethyl-1-[(4-methylphenyl)methyl]-2,6-bis(3-nitrophenyl)piperidin-4-one (PubChem CID 91554881) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is (2R,6S)-2,3-dimethyl-1-[(4-methylphenyl)methyl]-2,6-bis(3-nitrophenyl)piperidin-4-one.
| Compound Name | (2R,6S)-2,3-dimethyl-1-[(4-methylphenyl)methyl]-2,6-bis(3-nitrophenyl)piperidin-4-one |
|---|---|
| PubChem CID | 91554881 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | (2R,6S)-2,3-dimethyl-1-[(4-methylphenyl)methyl]-2,6-bis(3-nitrophenyl)piperidin-4-one |
| SMILES | Cc1ccc(CN2[C@H](c3cccc([N+](=O)[O-])c3)CC(=O)C(C)[C@]2(C)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C27H27N3O5/c1-18-10-12-20(13-11-18)17-28-25(21-6-4-8-23(14-21)29(32)33)16-26(31)19(2)27(28,3)22-7-5-9-24(15-22)30(34)35/h4-15,19,25H,16-17H2,1-3H3/t19?,25-,27+/m0/s1 |
| InChIKey | VEVZTNAARSMZMN-KKMBHWEUSA-N |
| XLogP | 5.88 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|